N-(butan-2-yl)-2-[(4-fluorophenyl)sulfanyl]quinoline-4-carboxamide
Chemical Structure Depiction of
N-(butan-2-yl)-2-[(4-fluorophenyl)sulfanyl]quinoline-4-carboxamide
N-(butan-2-yl)-2-[(4-fluorophenyl)sulfanyl]quinoline-4-carboxamide
Compound characteristics
| Compound ID: | C072-0268 |
| Compound Name: | N-(butan-2-yl)-2-[(4-fluorophenyl)sulfanyl]quinoline-4-carboxamide |
| Molecular Weight: | 354.44 |
| Molecular Formula: | C20 H19 F N2 O S |
| Smiles: | CCC(C)NC(c1cc(nc2ccccc12)Sc1ccc(cc1)F)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.1881 |
| logD: | 5.188 |
| logSw: | -5.1592 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 31.785 |
| InChI Key: | PZMHYZDBWMPLTC-ZDUSSCGKSA-N |