2-[(4-fluorophenyl)sulfanyl]-N-(3-methylbutyl)quinoline-4-carboxamide
Chemical Structure Depiction of
2-[(4-fluorophenyl)sulfanyl]-N-(3-methylbutyl)quinoline-4-carboxamide
2-[(4-fluorophenyl)sulfanyl]-N-(3-methylbutyl)quinoline-4-carboxamide
Compound characteristics
| Compound ID: | C072-0286 |
| Compound Name: | 2-[(4-fluorophenyl)sulfanyl]-N-(3-methylbutyl)quinoline-4-carboxamide |
| Molecular Weight: | 368.47 |
| Molecular Formula: | C21 H21 F N2 O S |
| Smiles: | CC(C)CCNC(c1cc(nc2ccccc12)Sc1ccc(cc1)F)=O |
| Stereo: | ACHIRAL |
| logP: | 5.9243 |
| logD: | 5.9243 |
| logSw: | -5.7301 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 32.185 |
| InChI Key: | JMCRRZSCIDODOZ-UHFFFAOYSA-N |