4-{[(2-chlorophenyl)methyl]sulfanyl}-7-(4-methoxyphenyl)-5-phenyl-7H-pyrrolo[2,3-d]pyrimidine
Chemical Structure Depiction of
4-{[(2-chlorophenyl)methyl]sulfanyl}-7-(4-methoxyphenyl)-5-phenyl-7H-pyrrolo[2,3-d]pyrimidine
4-{[(2-chlorophenyl)methyl]sulfanyl}-7-(4-methoxyphenyl)-5-phenyl-7H-pyrrolo[2,3-d]pyrimidine
Compound characteristics
| Compound ID: | C074-0096 |
| Compound Name: | 4-{[(2-chlorophenyl)methyl]sulfanyl}-7-(4-methoxyphenyl)-5-phenyl-7H-pyrrolo[2,3-d]pyrimidine |
| Molecular Weight: | 457.98 |
| Molecular Formula: | C26 H20 Cl N3 O S |
| Smiles: | COc1ccc(cc1)n1cc(c2ccccc2)c2c(ncnc12)SCc1ccccc1[Cl] |
| Stereo: | ACHIRAL |
| logP: | 6.9527 |
| logD: | 6.9524 |
| logSw: | -6.5722 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 30.2305 |
| InChI Key: | CJYSHFFYHPGJJI-UHFFFAOYSA-N |