4-(butylsulfanyl)-7-(4-ethoxyphenyl)-5-phenyl-7H-pyrrolo[2,3-d]pyrimidine
Chemical Structure Depiction of
4-(butylsulfanyl)-7-(4-ethoxyphenyl)-5-phenyl-7H-pyrrolo[2,3-d]pyrimidine
4-(butylsulfanyl)-7-(4-ethoxyphenyl)-5-phenyl-7H-pyrrolo[2,3-d]pyrimidine
Compound characteristics
| Compound ID: | C074-0117 |
| Compound Name: | 4-(butylsulfanyl)-7-(4-ethoxyphenyl)-5-phenyl-7H-pyrrolo[2,3-d]pyrimidine |
| Molecular Weight: | 403.55 |
| Molecular Formula: | C24 H25 N3 O S |
| Smiles: | CCCCSc1c2c(cn(c3ccc(cc3)OCC)c2ncn1)c1ccccc1 |
| Stereo: | ACHIRAL |
| logP: | 6.643 |
| logD: | 6.6427 |
| logSw: | -6.1016 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 30.0819 |
| InChI Key: | YOKNUGPHECYQLI-UHFFFAOYSA-N |