4-[(4-chlorophenoxy)acetyl]-7-fluoro-5-phenyl-1,3,4,5-tetrahydro-2H-1,4-benzodiazepin-2-one
Chemical Structure Depiction of
4-[(4-chlorophenoxy)acetyl]-7-fluoro-5-phenyl-1,3,4,5-tetrahydro-2H-1,4-benzodiazepin-2-one
4-[(4-chlorophenoxy)acetyl]-7-fluoro-5-phenyl-1,3,4,5-tetrahydro-2H-1,4-benzodiazepin-2-one
Compound characteristics
| Compound ID: | C076-0748 |
| Compound Name: | 4-[(4-chlorophenoxy)acetyl]-7-fluoro-5-phenyl-1,3,4,5-tetrahydro-2H-1,4-benzodiazepin-2-one |
| Molecular Weight: | 424.86 |
| Molecular Formula: | C23 H18 Cl F N2 O3 |
| Smiles: | C1C(Nc2ccc(cc2C(c2ccccc2)N1C(COc1ccc(cc1)[Cl])=O)F)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.3766 |
| logD: | 4.3766 |
| logSw: | -4.7485 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 47.998 |
| InChI Key: | CYDGSTMLMAUYQT-QHCPKHFHSA-N |