N'-(4-chlorophenyl)-N-[2-(dimethylamino)ethyl]-N-[(thiophen-2-yl)methyl]thiourea
Chemical Structure Depiction of
N'-(4-chlorophenyl)-N-[2-(dimethylamino)ethyl]-N-[(thiophen-2-yl)methyl]thiourea
N'-(4-chlorophenyl)-N-[2-(dimethylamino)ethyl]-N-[(thiophen-2-yl)methyl]thiourea
Compound characteristics
| Compound ID: | C087-0089 |
| Compound Name: | N'-(4-chlorophenyl)-N-[2-(dimethylamino)ethyl]-N-[(thiophen-2-yl)methyl]thiourea |
| Molecular Weight: | 353.93 |
| Molecular Formula: | C16 H20 Cl N3 S2 |
| Smiles: | CN(C)CCN(Cc1cccs1)C(Nc1ccc(cc1)[Cl])=S |
| Stereo: | ACHIRAL |
| logP: | 4.2135 |
| logD: | 1.5533 |
| logSw: | -4.4332 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 15.5619 |
| InChI Key: | OIDQRBVTYBBLLB-UHFFFAOYSA-N |