N-cyclohexyl-N'-(4-phenoxyphenyl)-N-[(thiophen-2-yl)methyl]thiourea
Chemical Structure Depiction of
N-cyclohexyl-N'-(4-phenoxyphenyl)-N-[(thiophen-2-yl)methyl]thiourea
N-cyclohexyl-N'-(4-phenoxyphenyl)-N-[(thiophen-2-yl)methyl]thiourea
Compound characteristics
| Compound ID: | C087-0397 |
| Compound Name: | N-cyclohexyl-N'-(4-phenoxyphenyl)-N-[(thiophen-2-yl)methyl]thiourea |
| Molecular Weight: | 422.61 |
| Molecular Formula: | C24 H26 N2 O S2 |
| Smiles: | C1CCC(CC1)N(Cc1cccs1)C(Nc1ccc(cc1)Oc1ccccc1)=S |
| Stereo: | ACHIRAL |
| logP: | 7.1873 |
| logD: | 7.1873 |
| logSw: | -6.0806 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 17.4387 |
| InChI Key: | OOZLBXWKTVPVJV-UHFFFAOYSA-N |