N'-(4-ethylphenyl)-N-[3-(pyrrolidin-1-yl)propyl]-N-[(thiophen-2-yl)methyl]thiourea
Chemical Structure Depiction of
N'-(4-ethylphenyl)-N-[3-(pyrrolidin-1-yl)propyl]-N-[(thiophen-2-yl)methyl]thiourea
N'-(4-ethylphenyl)-N-[3-(pyrrolidin-1-yl)propyl]-N-[(thiophen-2-yl)methyl]thiourea
Compound characteristics
| Compound ID: | C087-0416 |
| Compound Name: | N'-(4-ethylphenyl)-N-[3-(pyrrolidin-1-yl)propyl]-N-[(thiophen-2-yl)methyl]thiourea |
| Molecular Weight: | 387.61 |
| Molecular Formula: | C21 H29 N3 S2 |
| Smiles: | CCc1ccc(cc1)NC(N(CCCN1CCCC1)Cc1cccs1)=S |
| Stereo: | ACHIRAL |
| logP: | 5.2295 |
| logD: | 2.7328 |
| logSw: | -5.0196 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 15.7732 |
| InChI Key: | XHIDYAAJLNHVMD-UHFFFAOYSA-N |