N-[3-(3-methylpiperidin-1-yl)propyl]-N'-[3-(methylsulfanyl)phenyl]-N-[(thiophen-2-yl)methyl]thiourea
Chemical Structure Depiction of
N-[3-(3-methylpiperidin-1-yl)propyl]-N'-[3-(methylsulfanyl)phenyl]-N-[(thiophen-2-yl)methyl]thiourea
N-[3-(3-methylpiperidin-1-yl)propyl]-N'-[3-(methylsulfanyl)phenyl]-N-[(thiophen-2-yl)methyl]thiourea
Compound characteristics
| Compound ID: | C087-1343 |
| Compound Name: | N-[3-(3-methylpiperidin-1-yl)propyl]-N'-[3-(methylsulfanyl)phenyl]-N-[(thiophen-2-yl)methyl]thiourea |
| Molecular Weight: | 433.7 |
| Molecular Formula: | C22 H31 N3 S3 |
| Smiles: | CC1CCCN(CCCN(Cc2cccs2)C(Nc2cccc(c2)SC)=S)C1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.4112 |
| logD: | 3.3735 |
| logSw: | -5.4476 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 15.3406 |
| InChI Key: | CRVUUBTYQNLMAN-SFHVURJKSA-N |