3-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-5-(3-fluoroanilino)-6H-anthra[1,9-cd][1,2]oxazol-6-one
Chemical Structure Depiction of
3-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-5-(3-fluoroanilino)-6H-anthra[1,9-cd][1,2]oxazol-6-one
3-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-5-(3-fluoroanilino)-6H-anthra[1,9-cd][1,2]oxazol-6-one
Compound characteristics
| Compound ID: | C090-0219 |
| Compound Name: | 3-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-5-(3-fluoroanilino)-6H-anthra[1,9-cd][1,2]oxazol-6-one |
| Molecular Weight: | 471.49 |
| Molecular Formula: | C27 H22 F N3 O4 |
| Smiles: | C1CN(CCC12OCCO2)c1cc(c2C(c3ccccc3c3c2c1no3)=O)Nc1cccc(c1)F |
| Stereo: | ACHIRAL |
| logP: | 5.9195 |
| logD: | 5.9195 |
| logSw: | -6.1592 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 60.984 |
| InChI Key: | YXNFJKMXAOLEOD-UHFFFAOYSA-N |