N-[4-methyl-2-(piperidin-1-yl)quinolin-6-yl]-3-(3-methylthiophen-2-yl)prop-2-enamide
Chemical Structure Depiction of
N-[4-methyl-2-(piperidin-1-yl)quinolin-6-yl]-3-(3-methylthiophen-2-yl)prop-2-enamide
N-[4-methyl-2-(piperidin-1-yl)quinolin-6-yl]-3-(3-methylthiophen-2-yl)prop-2-enamide
Compound characteristics
| Compound ID: | C095-0107 |
| Compound Name: | N-[4-methyl-2-(piperidin-1-yl)quinolin-6-yl]-3-(3-methylthiophen-2-yl)prop-2-enamide |
| Molecular Weight: | 391.53 |
| Molecular Formula: | C23 H25 N3 O S |
| Smiles: | Cc1cc(nc2ccc(cc12)NC(/C=C/c1c(C)ccs1)=O)N1CCCCC1 |
| Stereo: | ACHIRAL |
| logP: | 6.1683 |
| logD: | 6.168 |
| logSw: | -5.3902 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 35.381 |
| InChI Key: | HJUBXCUBIAPKIF-UHFFFAOYSA-N |