N-(4-methyl-1,3-benzothiazol-2-yl)-N'-[2-(trifluoromethyl)-2H-1,3-benzodioxol-2-yl]urea
Chemical Structure Depiction of
N-(4-methyl-1,3-benzothiazol-2-yl)-N'-[2-(trifluoromethyl)-2H-1,3-benzodioxol-2-yl]urea
N-(4-methyl-1,3-benzothiazol-2-yl)-N'-[2-(trifluoromethyl)-2H-1,3-benzodioxol-2-yl]urea
Compound characteristics
| Compound ID: | C097-0071 |
| Compound Name: | N-(4-methyl-1,3-benzothiazol-2-yl)-N'-[2-(trifluoromethyl)-2H-1,3-benzodioxol-2-yl]urea |
| Molecular Weight: | 395.36 |
| Molecular Formula: | C17 H12 F3 N3 O3 S |
| Smiles: | Cc1cccc2c1nc(NC(NC1(C(F)(F)F)Oc3ccccc3O1)=O)s2 |
| Stereo: | ACHIRAL |
| logP: | 5.0183 |
| logD: | 4.5683 |
| logSw: | -4.7317 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 58.165 |
| InChI Key: | QJZXRIWNMJUIRO-UHFFFAOYSA-N |