3-(3,4-dimethylphenyl)-4-hydroxy-N-[(4-methylphenyl)methyl]-2-oxo-1,2,3,4-tetrahydroquinazoline-4-carboxamide
Chemical Structure Depiction of
3-(3,4-dimethylphenyl)-4-hydroxy-N-[(4-methylphenyl)methyl]-2-oxo-1,2,3,4-tetrahydroquinazoline-4-carboxamide
3-(3,4-dimethylphenyl)-4-hydroxy-N-[(4-methylphenyl)methyl]-2-oxo-1,2,3,4-tetrahydroquinazoline-4-carboxamide
Compound characteristics
| Compound ID: | C109-0077 |
| Compound Name: | 3-(3,4-dimethylphenyl)-4-hydroxy-N-[(4-methylphenyl)methyl]-2-oxo-1,2,3,4-tetrahydroquinazoline-4-carboxamide |
| Molecular Weight: | 415.49 |
| Molecular Formula: | C25 H25 N3 O3 |
| Smiles: | Cc1ccc(CNC(C2(c3ccccc3NC(N2c2ccc(C)c(C)c2)=O)O)=O)cc1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.8165 |
| logD: | 4.8165 |
| logSw: | -4.3263 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 67.105 |
| InChI Key: | WSSILZAHBFRYEZ-RUZDIDTESA-N |