6-bromo-3-(4-ethylphenyl)-N-[(4-fluorophenyl)methyl]-4-hydroxy-2-oxo-1,2,3,4-tetrahydroquinazoline-4-carboxamide
Chemical Structure Depiction of
6-bromo-3-(4-ethylphenyl)-N-[(4-fluorophenyl)methyl]-4-hydroxy-2-oxo-1,2,3,4-tetrahydroquinazoline-4-carboxamide
6-bromo-3-(4-ethylphenyl)-N-[(4-fluorophenyl)methyl]-4-hydroxy-2-oxo-1,2,3,4-tetrahydroquinazoline-4-carboxamide
Compound characteristics
| Compound ID: | C109-0731 |
| Compound Name: | 6-bromo-3-(4-ethylphenyl)-N-[(4-fluorophenyl)methyl]-4-hydroxy-2-oxo-1,2,3,4-tetrahydroquinazoline-4-carboxamide |
| Molecular Weight: | 498.35 |
| Molecular Formula: | C24 H21 Br F N3 O3 |
| Smiles: | CCc1ccc(cc1)N1C(Nc2ccc(cc2C1(C(NCc1ccc(cc1)F)=O)O)[Br])=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.1554 |
| logD: | 5.1554 |
| logSw: | -4.79 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 67.105 |
| InChI Key: | AIPJCHDNKQHJNY-XMMPIXPASA-N |