N-cycloheptyl-2-(4-fluorophenyl)-1-(4-methoxyphenyl)-6-oxopiperidine-3-carboxamide
Chemical Structure Depiction of
N-cycloheptyl-2-(4-fluorophenyl)-1-(4-methoxyphenyl)-6-oxopiperidine-3-carboxamide
N-cycloheptyl-2-(4-fluorophenyl)-1-(4-methoxyphenyl)-6-oxopiperidine-3-carboxamide
Compound characteristics
| Compound ID: | C125-0212 |
| Compound Name: | N-cycloheptyl-2-(4-fluorophenyl)-1-(4-methoxyphenyl)-6-oxopiperidine-3-carboxamide |
| Molecular Weight: | 438.54 |
| Molecular Formula: | C26 H31 F N2 O3 |
| Smiles: | COc1ccc(cc1)N1C(C(CCC1=O)C(NC1CCCCCC1)=O)c1ccc(cc1)F |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 4.8384 |
| logD: | 4.8384 |
| logSw: | -4.7108 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 47.602 |
| InChI Key: | VFZQLVVBQILVTN-UHFFFAOYSA-N |