3-(2-ethoxyethyl) 6-methyl 4-(2-butoxyphenyl)-2,7-dimethyl-5-oxo-1,4,5,6,7,8-hexahydroquinoline-3,6-dicarboxylate
Chemical Structure Depiction of
3-(2-ethoxyethyl) 6-methyl 4-(2-butoxyphenyl)-2,7-dimethyl-5-oxo-1,4,5,6,7,8-hexahydroquinoline-3,6-dicarboxylate
3-(2-ethoxyethyl) 6-methyl 4-(2-butoxyphenyl)-2,7-dimethyl-5-oxo-1,4,5,6,7,8-hexahydroquinoline-3,6-dicarboxylate
Compound characteristics
| Compound ID: | C142-0406 |
| Compound Name: | 3-(2-ethoxyethyl) 6-methyl 4-(2-butoxyphenyl)-2,7-dimethyl-5-oxo-1,4,5,6,7,8-hexahydroquinoline-3,6-dicarboxylate |
| Molecular Weight: | 499.6 |
| Molecular Formula: | C28 H37 N O7 |
| Smiles: | CCCCOc1ccccc1C1C(=C(C)NC2CC(C)C(C(C1=2)=O)C(=O)OC)C(=O)OCCOCC |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 4.8188 |
| logD: | 0.9848 |
| logSw: | -4.6245 |
| Hydrogen bond acceptors count: | 10 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 81.523 |
| InChI Key: | PXZHVBDNQFBZRQ-UHFFFAOYSA-N |