1-benzyl-3,5-bis[(3-bromo-4-fluorophenyl)methylidene]piperidin-4-one
Chemical Structure Depiction of
1-benzyl-3,5-bis[(3-bromo-4-fluorophenyl)methylidene]piperidin-4-one
1-benzyl-3,5-bis[(3-bromo-4-fluorophenyl)methylidene]piperidin-4-one
Compound characteristics
| Compound ID: | C151-0340 |
| Compound Name: | 1-benzyl-3,5-bis[(3-bromo-4-fluorophenyl)methylidene]piperidin-4-one |
| Molecular Weight: | 559.25 |
| Molecular Formula: | C26 H19 Br2 F2 N O |
| Smiles: | C1/C(=C\c2ccc(c(c2)[Br])F)C(C(\CN1Cc1ccccc1)=C\c1ccc(c(c1)[Br])F)=O |
| Stereo: | ACHIRAL |
| logP: | 6.485 |
| logD: | 6.4849 |
| logSw: | -6.0396 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 16.4412 |
| InChI Key: | BAGGJABEWRCEIS-UHFFFAOYSA-N |