1-methyl-3,5-bis{[4-(pentyloxy)phenyl]methylidene}piperidin-4-one
Chemical Structure Depiction of
1-methyl-3,5-bis{[4-(pentyloxy)phenyl]methylidene}piperidin-4-one
1-methyl-3,5-bis{[4-(pentyloxy)phenyl]methylidene}piperidin-4-one
Compound characteristics
| Compound ID: | C151-0498 |
| Compound Name: | 1-methyl-3,5-bis{[4-(pentyloxy)phenyl]methylidene}piperidin-4-one |
| Molecular Weight: | 461.65 |
| Molecular Formula: | C30 H39 N O3 |
| Smiles: | CCCCCOc1ccc(/C=C2/CN(C)C/C(=C\c3ccc(cc3)OCCCCC)C2=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 7.7333 |
| logD: | 7.7329 |
| logSw: | -5.6758 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 31.2128 |
| InChI Key: | MTPPSWYEUKGHKQ-UHFFFAOYSA-N |