4-(2-methylbutan-2-yl)-2,6-bis[(thiophen-3-yl)methylidene]cyclohexan-1-one
Chemical Structure Depiction of
4-(2-methylbutan-2-yl)-2,6-bis[(thiophen-3-yl)methylidene]cyclohexan-1-one
4-(2-methylbutan-2-yl)-2,6-bis[(thiophen-3-yl)methylidene]cyclohexan-1-one
Compound characteristics
| Compound ID: | C151-0541 |
| Compound Name: | 4-(2-methylbutan-2-yl)-2,6-bis[(thiophen-3-yl)methylidene]cyclohexan-1-one |
| Molecular Weight: | 356.55 |
| Molecular Formula: | C21 H24 O S2 |
| Smiles: | CCC(C)(C)C1C/C(=C\c2ccsc2)C(C(\C1)=C\c1ccsc1)=O |
| Stereo: | ACHIRAL |
| logP: | 6.0457 |
| logD: | 6.0457 |
| logSw: | -5.5075 |
| Hydrogen bond acceptors count: | 2 |
| Polar surface area: | 15.0706 |
| InChI Key: | BTEUPJLUNICIRF-UHFFFAOYSA-N |