2-[(4-bromothiophen-2-yl)methylidene]-2,3-dihydro-1H-inden-1-one
Chemical Structure Depiction of
2-[(4-bromothiophen-2-yl)methylidene]-2,3-dihydro-1H-inden-1-one
2-[(4-bromothiophen-2-yl)methylidene]-2,3-dihydro-1H-inden-1-one
Compound characteristics
| Compound ID: | C151-0718 |
| Compound Name: | 2-[(4-bromothiophen-2-yl)methylidene]-2,3-dihydro-1H-inden-1-one |
| Molecular Weight: | 305.19 |
| Molecular Formula: | C14 H9 Br O S |
| Smiles: | C1/C(=C\c2cc(cs2)[Br])C(c2ccccc12)=O |
| Stereo: | ACHIRAL |
| logP: | 4.5436 |
| logD: | 4.5436 |
| logSw: | -4.6667 |
| Hydrogen bond acceptors count: | 2 |
| Polar surface area: | 14.4182 |
| InChI Key: | MAEGYFHHQARGNJ-UHFFFAOYSA-N |