(2E,4E)-2,4-bis[(3-bromo-4-methoxyphenyl)methylidene]-8-methyl-8-azabicyclo[3.2.1]octan-3-one
Chemical Structure Depiction of
(2E,4E)-2,4-bis[(3-bromo-4-methoxyphenyl)methylidene]-8-methyl-8-azabicyclo[3.2.1]octan-3-one
(2E,4E)-2,4-bis[(3-bromo-4-methoxyphenyl)methylidene]-8-methyl-8-azabicyclo[3.2.1]octan-3-one
Compound characteristics
| Compound ID: | C151-0858 |
| Compound Name: | (2E,4E)-2,4-bis[(3-bromo-4-methoxyphenyl)methylidene]-8-methyl-8-azabicyclo[3.2.1]octan-3-one |
| Molecular Weight: | 533.26 |
| Molecular Formula: | C24 H23 Br2 N O3 |
| Smiles: | CN1C2CCC1/C(=C\c1ccc(c(c1)[Br])OC)C(C/2=C\c1ccc(c(c1)[Br])OC)=O |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 5.6558 |
| logD: | 5.652 |
| logSw: | -5.5015 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 30.7232 |
| InChI Key: | BRRUELWUZMTEJK-UHFFFAOYSA-N |