4-butoxy-N-{2-[(1H-indol-3-yl)sulfanyl]ethyl}benzamide
Chemical Structure Depiction of
4-butoxy-N-{2-[(1H-indol-3-yl)sulfanyl]ethyl}benzamide
4-butoxy-N-{2-[(1H-indol-3-yl)sulfanyl]ethyl}benzamide
Compound characteristics
| Compound ID: | C156-0125 |
| Compound Name: | 4-butoxy-N-{2-[(1H-indol-3-yl)sulfanyl]ethyl}benzamide |
| Molecular Weight: | 368.5 |
| Molecular Formula: | C21 H24 N2 O2 S |
| Smiles: | CCCCOc1ccc(cc1)C(NCCSc1c[nH]c2ccccc12)=O |
| Stereo: | ACHIRAL |
| logP: | 4.7634 |
| logD: | 4.7634 |
| logSw: | -4.5792 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 41.782 |
| InChI Key: | JKHGRKHLPCKAKE-UHFFFAOYSA-N |