2-(2,4-difluorophenyl)-4-methyl-1H-pyrrolo[3,4-c]quinoline-1,3(2H)-dione
Chemical Structure Depiction of
2-(2,4-difluorophenyl)-4-methyl-1H-pyrrolo[3,4-c]quinoline-1,3(2H)-dione
2-(2,4-difluorophenyl)-4-methyl-1H-pyrrolo[3,4-c]quinoline-1,3(2H)-dione
Compound characteristics
| Compound ID: | C160-0051 |
| Compound Name: | 2-(2,4-difluorophenyl)-4-methyl-1H-pyrrolo[3,4-c]quinoline-1,3(2H)-dione |
| Molecular Weight: | 324.28 |
| Molecular Formula: | C18 H10 F2 N2 O2 |
| Smiles: | Cc1c2C(N(C(c2c2ccccc2n1)=O)c1ccc(cc1F)F)=O |
| Stereo: | ACHIRAL |
| logP: | 2.5762 |
| logD: | 2.5762 |
| logSw: | -3.0111 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 37.486 |
| InChI Key: | SVDPPYUIVJCEKW-UHFFFAOYSA-N |