4-(3,5-dimethyl-4-nitro-1H-pyrazol-1-yl)-N-(3-hydroxyphenyl)butanamide
Chemical Structure Depiction of
4-(3,5-dimethyl-4-nitro-1H-pyrazol-1-yl)-N-(3-hydroxyphenyl)butanamide
4-(3,5-dimethyl-4-nitro-1H-pyrazol-1-yl)-N-(3-hydroxyphenyl)butanamide
Compound characteristics
| Compound ID: | C163-0236 |
| Compound Name: | 4-(3,5-dimethyl-4-nitro-1H-pyrazol-1-yl)-N-(3-hydroxyphenyl)butanamide |
| Molecular Weight: | 318.33 |
| Molecular Formula: | C15 H18 N4 O4 |
| Smiles: | Cc1c(c(C)n(CCCC(Nc2cccc(c2)O)=O)n1)[N+]([O-])=O |
| Stereo: | ACHIRAL |
| logP: | 0.8138 |
| logD: | 0.8069 |
| logSw: | -1.8855 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 88.045 |
| InChI Key: | GJPJOGTXLFGXCZ-UHFFFAOYSA-N |