N-(2,4-dimethoxyphenyl)-4-(3,5-dimethyl-4-nitro-1H-pyrazol-1-yl)butanamide
Chemical Structure Depiction of
N-(2,4-dimethoxyphenyl)-4-(3,5-dimethyl-4-nitro-1H-pyrazol-1-yl)butanamide
N-(2,4-dimethoxyphenyl)-4-(3,5-dimethyl-4-nitro-1H-pyrazol-1-yl)butanamide
Compound characteristics
| Compound ID: | C163-0270 |
| Compound Name: | N-(2,4-dimethoxyphenyl)-4-(3,5-dimethyl-4-nitro-1H-pyrazol-1-yl)butanamide |
| Molecular Weight: | 362.38 |
| Molecular Formula: | C17 H22 N4 O5 |
| Smiles: | Cc1c(c(C)n(CCCC(Nc2ccc(cc2OC)OC)=O)n1)[N+]([O-])=O |
| Stereo: | ACHIRAL |
| logP: | 1.1757 |
| logD: | 1.1751 |
| logSw: | -2.2438 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 84.904 |
| InChI Key: | GJFNLINQOPATRS-UHFFFAOYSA-N |