N-(2-ethyl-6-methylphenyl)-2-(4-methylphenyl)imidazo[1,2-a]pyrazin-3-amine
Chemical Structure Depiction of
N-(2-ethyl-6-methylphenyl)-2-(4-methylphenyl)imidazo[1,2-a]pyrazin-3-amine
N-(2-ethyl-6-methylphenyl)-2-(4-methylphenyl)imidazo[1,2-a]pyrazin-3-amine
Compound characteristics
| Compound ID: | C169-0363 |
| Compound Name: | N-(2-ethyl-6-methylphenyl)-2-(4-methylphenyl)imidazo[1,2-a]pyrazin-3-amine |
| Molecular Weight: | 342.44 |
| Molecular Formula: | C22 H22 N4 |
| Smiles: | CCc1cccc(C)c1Nc1c(c2ccc(C)cc2)nc2cnccn12 |
| Stereo: | ACHIRAL |
| logP: | 4.6576 |
| logD: | 4.6434 |
| logSw: | -4.1223 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 25.8011 |
| InChI Key: | QUMNAIGTGJTIKG-UHFFFAOYSA-N |