N-benzyl-6-(2,4-dioxo-1,4-dihydrothieno[3,2-d]pyrimidin-3(2H)-yl)hexanamide
Chemical Structure Depiction of
N-benzyl-6-(2,4-dioxo-1,4-dihydrothieno[3,2-d]pyrimidin-3(2H)-yl)hexanamide
N-benzyl-6-(2,4-dioxo-1,4-dihydrothieno[3,2-d]pyrimidin-3(2H)-yl)hexanamide
Compound characteristics
| Compound ID: | C172-0501 |
| Compound Name: | N-benzyl-6-(2,4-dioxo-1,4-dihydrothieno[3,2-d]pyrimidin-3(2H)-yl)hexanamide |
| Molecular Weight: | 371.46 |
| Molecular Formula: | C19 H21 N3 O3 S |
| Smiles: | C(CCC(NCc1ccccc1)=O)CCN1C(c2c(ccs2)NC1=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.6742 |
| logD: | 2.6737 |
| logSw: | -3.0411 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 65.949 |
| InChI Key: | PNKDKUJMXASHJA-UHFFFAOYSA-N |