N-({1-[(2,5-dimethylphenyl)methyl]-1H-benzimidazol-2-yl}methyl)acetamide
Chemical Structure Depiction of
N-({1-[(2,5-dimethylphenyl)methyl]-1H-benzimidazol-2-yl}methyl)acetamide
N-({1-[(2,5-dimethylphenyl)methyl]-1H-benzimidazol-2-yl}methyl)acetamide
Compound characteristics
| Compound ID: | C174-0110 |
| Compound Name: | N-({1-[(2,5-dimethylphenyl)methyl]-1H-benzimidazol-2-yl}methyl)acetamide |
| Molecular Weight: | 307.39 |
| Molecular Formula: | C19 H21 N3 O |
| Smiles: | CC(NCc1nc2ccccc2n1Cc1cc(C)ccc1C)=O |
| Stereo: | ACHIRAL |
| logP: | 3.4662 |
| logD: | 3.4624 |
| logSw: | -3.547 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 35.727 |
| InChI Key: | NFVUCIDEFFIWQF-UHFFFAOYSA-N |