2-methoxy-N-[2-(1-methyl-1H-benzimidazol-2-yl)ethyl]acetamide
Chemical Structure Depiction of
2-methoxy-N-[2-(1-methyl-1H-benzimidazol-2-yl)ethyl]acetamide
2-methoxy-N-[2-(1-methyl-1H-benzimidazol-2-yl)ethyl]acetamide
Compound characteristics
| Compound ID: | C174-0484 |
| Compound Name: | 2-methoxy-N-[2-(1-methyl-1H-benzimidazol-2-yl)ethyl]acetamide |
| Molecular Weight: | 247.29 |
| Molecular Formula: | C13 H17 N3 O2 |
| Smiles: | Cn1c2ccccc2nc1CCNC(COC)=O |
| Stereo: | ACHIRAL |
| logP: | 0.4233 |
| logD: | 0.3539 |
| logSw: | -1.7775 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 44.962 |
| InChI Key: | ANUWAYMSYDYMJY-UHFFFAOYSA-N |