N-[2-(1-butyl-1H-benzimidazol-2-yl)ethyl]butanamide
Chemical Structure Depiction of
N-[2-(1-butyl-1H-benzimidazol-2-yl)ethyl]butanamide
N-[2-(1-butyl-1H-benzimidazol-2-yl)ethyl]butanamide
Compound characteristics
| Compound ID: | C174-0546 |
| Compound Name: | N-[2-(1-butyl-1H-benzimidazol-2-yl)ethyl]butanamide |
| Molecular Weight: | 287.4 |
| Molecular Formula: | C17 H25 N3 O |
| Smiles: | CCCCn1c2ccccc2nc1CCNC(CCC)=O |
| Stereo: | ACHIRAL |
| logP: | 3.1409 |
| logD: | 3.1388 |
| logSw: | -3.1278 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 35.706 |
| InChI Key: | LSSSVQVFNFTZKD-UHFFFAOYSA-N |