N-(3-{1-[(2-fluorophenyl)methyl]-1H-benzimidazol-2-yl}propyl)-3,4,5-trimethoxybenzamide
Chemical Structure Depiction of
N-(3-{1-[(2-fluorophenyl)methyl]-1H-benzimidazol-2-yl}propyl)-3,4,5-trimethoxybenzamide
N-(3-{1-[(2-fluorophenyl)methyl]-1H-benzimidazol-2-yl}propyl)-3,4,5-trimethoxybenzamide
Compound characteristics
| Compound ID: | C174-0834 |
| Compound Name: | N-(3-{1-[(2-fluorophenyl)methyl]-1H-benzimidazol-2-yl}propyl)-3,4,5-trimethoxybenzamide |
| Molecular Weight: | 477.54 |
| Molecular Formula: | C27 H28 F N3 O4 |
| Smiles: | COc1cc(cc(c1OC)OC)C(NCCCc1nc2ccccc2n1Cc1ccccc1F)=O |
| Stereo: | ACHIRAL |
| logP: | 4.571 |
| logD: | 4.5698 |
| logSw: | -4.3843 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 58.376 |
| InChI Key: | IXASREOJOJILAO-UHFFFAOYSA-N |