2-{[4-(benzenesulfonyl)-2-phenyl-1,3-oxazol-5-yl]sulfanyl}-N-cyclohexylacetamide
Chemical Structure Depiction of
2-{[4-(benzenesulfonyl)-2-phenyl-1,3-oxazol-5-yl]sulfanyl}-N-cyclohexylacetamide
2-{[4-(benzenesulfonyl)-2-phenyl-1,3-oxazol-5-yl]sulfanyl}-N-cyclohexylacetamide
Compound characteristics
| Compound ID: | C176-0005 |
| Compound Name: | 2-{[4-(benzenesulfonyl)-2-phenyl-1,3-oxazol-5-yl]sulfanyl}-N-cyclohexylacetamide |
| Molecular Weight: | 456.58 |
| Molecular Formula: | C23 H24 N2 O4 S2 |
| Smiles: | C1CCC(CC1)NC(CSc1c(nc(c2ccccc2)o1)S(c1ccccc1)(=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.7725 |
| logD: | 4.7725 |
| logSw: | -4.6571 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 71.865 |
| InChI Key: | KOGPLQNJJINNLX-UHFFFAOYSA-N |