4-(4-chlorobenzene-1-sulfonyl)-5-{[(2-chlorophenyl)methyl]sulfanyl}-2-(thiophen-2-yl)-1,3-oxazole
					Chemical Structure Depiction of
4-(4-chlorobenzene-1-sulfonyl)-5-{[(2-chlorophenyl)methyl]sulfanyl}-2-(thiophen-2-yl)-1,3-oxazole
			4-(4-chlorobenzene-1-sulfonyl)-5-{[(2-chlorophenyl)methyl]sulfanyl}-2-(thiophen-2-yl)-1,3-oxazole
Compound characteristics
| Compound ID: | C176-0320 | 
| Compound Name: | 4-(4-chlorobenzene-1-sulfonyl)-5-{[(2-chlorophenyl)methyl]sulfanyl}-2-(thiophen-2-yl)-1,3-oxazole | 
| Molecular Weight: | 482.42 | 
| Molecular Formula: | C20 H13 Cl2 N O3 S3 | 
| Smiles: | C(c1ccccc1[Cl])Sc1c(nc(c2cccs2)o1)S(c1ccc(cc1)[Cl])(=O)=O | 
| Stereo: | ACHIRAL | 
| logP: | 6.8639 | 
| logD: | 6.8639 | 
| logSw: | -6.5729 | 
| Hydrogen bond acceptors count: | 7 | 
| Polar surface area: | 48.687 | 
| InChI Key: | BDZIUOCJOZPGOA-UHFFFAOYSA-N | 
 
				 
				