4-(benzenesulfonyl)-2-(furan-2-yl)-5-(methylsulfanyl)-1,3-oxazole
Chemical Structure Depiction of
4-(benzenesulfonyl)-2-(furan-2-yl)-5-(methylsulfanyl)-1,3-oxazole
4-(benzenesulfonyl)-2-(furan-2-yl)-5-(methylsulfanyl)-1,3-oxazole
Compound characteristics
| Compound ID: | C176-0356 |
| Compound Name: | 4-(benzenesulfonyl)-2-(furan-2-yl)-5-(methylsulfanyl)-1,3-oxazole |
| Molecular Weight: | 321.37 |
| Molecular Formula: | C14 H11 N O4 S2 |
| Smiles: | CSc1c(nc(c2ccco2)o1)S(c1ccccc1)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.2011 |
| logD: | 3.2011 |
| logSw: | -3.4654 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 56.518 |
| InChI Key: | OXQJVTWLINUNRV-UHFFFAOYSA-N |