4-(4-fluorobenzene-1-sulfonyl)-2-(furan-2-yl)-5-(pentylsulfanyl)-1,3-oxazole
Chemical Structure Depiction of
4-(4-fluorobenzene-1-sulfonyl)-2-(furan-2-yl)-5-(pentylsulfanyl)-1,3-oxazole
4-(4-fluorobenzene-1-sulfonyl)-2-(furan-2-yl)-5-(pentylsulfanyl)-1,3-oxazole
Compound characteristics
| Compound ID: | C176-0416 |
| Compound Name: | 4-(4-fluorobenzene-1-sulfonyl)-2-(furan-2-yl)-5-(pentylsulfanyl)-1,3-oxazole |
| Molecular Weight: | 395.47 |
| Molecular Formula: | C18 H18 F N O4 S2 |
| Smiles: | CCCCCSc1c(nc(c2ccco2)o1)S(c1ccc(cc1)F)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 5.5446 |
| logD: | 5.5446 |
| logSw: | -5.3681 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 56.518 |
| InChI Key: | XWWGDPGGPBDJQD-UHFFFAOYSA-N |