3-{2-[ethyl(2-methylphenyl)amino]-2-oxoethyl}-1H-indole-2-carboxylic acid
Chemical Structure Depiction of
3-{2-[ethyl(2-methylphenyl)amino]-2-oxoethyl}-1H-indole-2-carboxylic acid
3-{2-[ethyl(2-methylphenyl)amino]-2-oxoethyl}-1H-indole-2-carboxylic acid
Compound characteristics
| Compound ID: | C197-0503 |
| Compound Name: | 3-{2-[ethyl(2-methylphenyl)amino]-2-oxoethyl}-1H-indole-2-carboxylic acid |
| Molecular Weight: | 336.39 |
| Molecular Formula: | C20 H20 N2 O3 |
| Smiles: | CCN(C(Cc1c2ccccc2[nH]c1C(O)=O)=O)c1ccccc1C |
| Stereo: | ACHIRAL |
| logP: | 3.336 |
| logD: | 0.7816 |
| logSw: | -3.3386 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 53.285 |
| InChI Key: | JVRSWCDBGQUTGS-UHFFFAOYSA-N |