N'-(3-methoxyphenyl)-N-[2-(2-methyl-1H-indol-3-yl)ethyl]-N-[(thiophen-2-yl)methyl]thiourea
Chemical Structure Depiction of
N'-(3-methoxyphenyl)-N-[2-(2-methyl-1H-indol-3-yl)ethyl]-N-[(thiophen-2-yl)methyl]thiourea
N'-(3-methoxyphenyl)-N-[2-(2-methyl-1H-indol-3-yl)ethyl]-N-[(thiophen-2-yl)methyl]thiourea
Compound characteristics
| Compound ID: | C198-0113 |
| Compound Name: | N'-(3-methoxyphenyl)-N-[2-(2-methyl-1H-indol-3-yl)ethyl]-N-[(thiophen-2-yl)methyl]thiourea |
| Molecular Weight: | 435.61 |
| Molecular Formula: | C24 H25 N3 O S2 |
| Smiles: | Cc1c(CCN(Cc2cccs2)C(Nc2cccc(c2)OC)=S)c2ccccc2[nH]1 |
| Stereo: | ACHIRAL |
| logP: | 5.8545 |
| logD: | 5.8545 |
| logSw: | -5.9015 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 28.8944 |
| InChI Key: | FVZIWOKPRSIMEC-UHFFFAOYSA-N |