N-[(3,4-dimethoxyphenyl)methyl]-N-[2-(5-fluoro-2-methyl-1H-indol-3-yl)ethyl]-N'-(2-methoxyethyl)thiourea
Chemical Structure Depiction of
N-[(3,4-dimethoxyphenyl)methyl]-N-[2-(5-fluoro-2-methyl-1H-indol-3-yl)ethyl]-N'-(2-methoxyethyl)thiourea
N-[(3,4-dimethoxyphenyl)methyl]-N-[2-(5-fluoro-2-methyl-1H-indol-3-yl)ethyl]-N'-(2-methoxyethyl)thiourea
Compound characteristics
| Compound ID: | C198-0221 |
| Compound Name: | N-[(3,4-dimethoxyphenyl)methyl]-N-[2-(5-fluoro-2-methyl-1H-indol-3-yl)ethyl]-N'-(2-methoxyethyl)thiourea |
| Molecular Weight: | 459.58 |
| Molecular Formula: | C24 H30 F N3 O3 S |
| Smiles: | Cc1c(CCN(Cc2ccc(c(c2)OC)OC)C(NCCOC)=S)c2cc(ccc2[nH]1)F |
| Stereo: | ACHIRAL |
| logP: | 3.9476 |
| logD: | 3.9476 |
| logSw: | -4.2633 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 45.371 |
| InChI Key: | OJEHGOLXONIZPP-UHFFFAOYSA-N |