3-amino-4-(4-bromophenyl)-N~5~-(4-chlorophenyl)-6-methyl-N~2~-[(4-methylphenyl)methyl]thieno[2,3-b]pyridine-2,5-dicarboxamide
Chemical Structure Depiction of
3-amino-4-(4-bromophenyl)-N~5~-(4-chlorophenyl)-6-methyl-N~2~-[(4-methylphenyl)methyl]thieno[2,3-b]pyridine-2,5-dicarboxamide
3-amino-4-(4-bromophenyl)-N~5~-(4-chlorophenyl)-6-methyl-N~2~-[(4-methylphenyl)methyl]thieno[2,3-b]pyridine-2,5-dicarboxamide
Compound characteristics
| Compound ID: | C200-0517 |
| Compound Name: | 3-amino-4-(4-bromophenyl)-N~5~-(4-chlorophenyl)-6-methyl-N~2~-[(4-methylphenyl)methyl]thieno[2,3-b]pyridine-2,5-dicarboxamide |
| Molecular Weight: | 619.97 |
| Molecular Formula: | C30 H24 Br Cl N4 O2 S |
| Smiles: | Cc1ccc(CNC(c2c(c3c(c4ccc(cc4)[Br])c(C(Nc4ccc(cc4)[Cl])=O)c(C)nc3s2)N)=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 7.71 |
| logD: | 7.7067 |
| logSw: | -6.7202 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 4 |
| Polar surface area: | 77.155 |
| InChI Key: | FJXLYACARDLGTM-UHFFFAOYSA-N |