3-benzyl-7-[2-(4-ethylphenyl)-2-oxoethoxy]-4-methyl-2H-1-benzopyran-2-one
Chemical Structure Depiction of
3-benzyl-7-[2-(4-ethylphenyl)-2-oxoethoxy]-4-methyl-2H-1-benzopyran-2-one
3-benzyl-7-[2-(4-ethylphenyl)-2-oxoethoxy]-4-methyl-2H-1-benzopyran-2-one
Compound characteristics
| Compound ID: | C200-2192 |
| Compound Name: | 3-benzyl-7-[2-(4-ethylphenyl)-2-oxoethoxy]-4-methyl-2H-1-benzopyran-2-one |
| Molecular Weight: | 412.48 |
| Molecular Formula: | C27 H24 O4 |
| Smiles: | CCc1ccc(cc1)C(COc1ccc2C(C)=C(Cc3ccccc3)C(=O)Oc2c1)=O |
| Stereo: | ACHIRAL |
| logP: | 5.7735 |
| logD: | 5.7735 |
| logSw: | -5.651 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 41.363 |
| InChI Key: | XCLDPCAUJFNPIF-UHFFFAOYSA-N |