5-{2-[(4-chlorophenyl)methylidene]hydrazinyl}-3-phenyl[1,2,3]triazolo[1,5-a]quinazoline
Chemical Structure Depiction of
5-{2-[(4-chlorophenyl)methylidene]hydrazinyl}-3-phenyl[1,2,3]triazolo[1,5-a]quinazoline
5-{2-[(4-chlorophenyl)methylidene]hydrazinyl}-3-phenyl[1,2,3]triazolo[1,5-a]quinazoline
Compound characteristics
| Compound ID: | C200-2340 |
| Compound Name: | 5-{2-[(4-chlorophenyl)methylidene]hydrazinyl}-3-phenyl[1,2,3]triazolo[1,5-a]quinazoline |
| Molecular Weight: | 398.85 |
| Molecular Formula: | C22 H15 Cl N6 |
| Smiles: | C(\c1ccc(cc1)[Cl])=N/Nc1c2ccccc2n2c(c(c3ccccc3)nn2)n1 |
| Stereo: | ACHIRAL |
| logP: | 5.4239 |
| logD: | 5.4233 |
| logSw: | -6.5029 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 53.972 |
| InChI Key: | NNRFJOQZAIZKCG-UHFFFAOYSA-N |