ethyl 3-{[4-(4-fluorophenyl)piperazine-1-carbothioyl]amino}-5-methoxy-1H-indole-2-carboxylate
Chemical Structure Depiction of
ethyl 3-{[4-(4-fluorophenyl)piperazine-1-carbothioyl]amino}-5-methoxy-1H-indole-2-carboxylate
ethyl 3-{[4-(4-fluorophenyl)piperazine-1-carbothioyl]amino}-5-methoxy-1H-indole-2-carboxylate
Compound characteristics
| Compound ID: | C200-2537 |
| Compound Name: | ethyl 3-{[4-(4-fluorophenyl)piperazine-1-carbothioyl]amino}-5-methoxy-1H-indole-2-carboxylate |
| Molecular Weight: | 456.54 |
| Molecular Formula: | C23 H25 F N4 O3 S |
| Smiles: | CCOC(c1c(c2cc(ccc2[nH]1)OC)NC(N1CCN(CC1)c1ccc(cc1)F)=S)=O |
| Stereo: | ACHIRAL |
| logP: | 4.0178 |
| logD: | 4.0174 |
| logSw: | -4.1303 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 51.418 |
| InChI Key: | GCNGSUFDUBLPRW-UHFFFAOYSA-N |