5-(hydroxymethyl)-2-[(3-methoxyphenyl)imino]-8-methyl-2H-pyrano[2,3-c]pyridine-3-carbothioamide
Chemical Structure Depiction of
5-(hydroxymethyl)-2-[(3-methoxyphenyl)imino]-8-methyl-2H-pyrano[2,3-c]pyridine-3-carbothioamide
5-(hydroxymethyl)-2-[(3-methoxyphenyl)imino]-8-methyl-2H-pyrano[2,3-c]pyridine-3-carbothioamide
Compound characteristics
| Compound ID: | C200-2759 |
| Compound Name: | 5-(hydroxymethyl)-2-[(3-methoxyphenyl)imino]-8-methyl-2H-pyrano[2,3-c]pyridine-3-carbothioamide |
| Molecular Weight: | 355.41 |
| Molecular Formula: | C18 H17 N3 O3 S |
| Smiles: | Cc1c2c(C=C(/C(=N/c3cccc(c3)OC)O2)C(N)=S)c(CO)cn1 |
| Stereo: | ACHIRAL |
| logP: | 1.9734 |
| logD: | 1.9734 |
| logSw: | -2.3835 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 69.455 |
| InChI Key: | MLQKJRHZEVFIBU-UHFFFAOYSA-N |