7-(benzyloxy)-2-[(3,5-dimethoxyphenyl)imino]-2H-1-benzopyran-3-carboxamide
Chemical Structure Depiction of
7-(benzyloxy)-2-[(3,5-dimethoxyphenyl)imino]-2H-1-benzopyran-3-carboxamide
7-(benzyloxy)-2-[(3,5-dimethoxyphenyl)imino]-2H-1-benzopyran-3-carboxamide
Compound characteristics
| Compound ID: | C200-3334 |
| Compound Name: | 7-(benzyloxy)-2-[(3,5-dimethoxyphenyl)imino]-2H-1-benzopyran-3-carboxamide |
| Molecular Weight: | 430.46 |
| Molecular Formula: | C25 H22 N2 O5 |
| Smiles: | COc1cc(cc(c1)OC)/N=C1/C(=Cc2ccc(cc2O1)OCc1ccccc1)C(N)=O |
| Stereo: | ACHIRAL |
| logP: | 4.084 |
| logD: | 4.084 |
| logSw: | -4.7306 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 72.319 |
| InChI Key: | MHLGRJVMIRCDBH-UHFFFAOYSA-N |