methyl 3-[benzyl(methanesulfonyl)amino]thiophene-2-carboxylate
Chemical Structure Depiction of
methyl 3-[benzyl(methanesulfonyl)amino]thiophene-2-carboxylate
methyl 3-[benzyl(methanesulfonyl)amino]thiophene-2-carboxylate
Compound characteristics
| Compound ID: | C200-3713 |
| Compound Name: | methyl 3-[benzyl(methanesulfonyl)amino]thiophene-2-carboxylate |
| Molecular Weight: | 325.4 |
| Molecular Formula: | C14 H15 N O4 S2 |
| Smiles: | COC(c1c(ccs1)N(Cc1ccccc1)S(C)(=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.6201 |
| logD: | 2.6201 |
| logSw: | -2.8957 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 53.447 |
| InChI Key: | HWJZGOAKOHKGJK-UHFFFAOYSA-N |