2-[(3-ethyl-4-oxo-3,4-dihydrothieno[3,2-d]pyrimidin-2-yl)sulfanyl]-N-(3-ethylphenyl)acetamide
Chemical Structure Depiction of
2-[(3-ethyl-4-oxo-3,4-dihydrothieno[3,2-d]pyrimidin-2-yl)sulfanyl]-N-(3-ethylphenyl)acetamide
2-[(3-ethyl-4-oxo-3,4-dihydrothieno[3,2-d]pyrimidin-2-yl)sulfanyl]-N-(3-ethylphenyl)acetamide
Compound characteristics
| Compound ID: | C200-3765 |
| Compound Name: | 2-[(3-ethyl-4-oxo-3,4-dihydrothieno[3,2-d]pyrimidin-2-yl)sulfanyl]-N-(3-ethylphenyl)acetamide |
| Molecular Weight: | 373.49 |
| Molecular Formula: | C18 H19 N3 O2 S2 |
| Smiles: | CCc1cccc(c1)NC(CSC1=Nc2ccsc2C(N1CC)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.8751 |
| logD: | 3.8751 |
| logSw: | -3.8586 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 49.935 |
| InChI Key: | LGMVRHRTFLHEKU-UHFFFAOYSA-N |