2-chloro-N-[3-(5-methyl-1-phenyl-1H-1,2,3-triazol-4-yl)-1,2,4-thiadiazol-5-yl]benzamide
Chemical Structure Depiction of
2-chloro-N-[3-(5-methyl-1-phenyl-1H-1,2,3-triazol-4-yl)-1,2,4-thiadiazol-5-yl]benzamide
2-chloro-N-[3-(5-methyl-1-phenyl-1H-1,2,3-triazol-4-yl)-1,2,4-thiadiazol-5-yl]benzamide
Compound characteristics
| Compound ID: | C200-4489 |
| Compound Name: | 2-chloro-N-[3-(5-methyl-1-phenyl-1H-1,2,3-triazol-4-yl)-1,2,4-thiadiazol-5-yl]benzamide |
| Molecular Weight: | 396.86 |
| Molecular Formula: | C18 H13 Cl N6 O S |
| Smiles: | Cc1c(c2nc(NC(c3ccccc3[Cl])=O)sn2)nnn1c1ccccc1 |
| Stereo: | ACHIRAL |
| logP: | 3.8648 |
| logD: | 3.83 |
| logSw: | -4.3276 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 70.76 |
| InChI Key: | MXIYKPQRGUQQCN-UHFFFAOYSA-N |