4-tert-butyl-N-{3-[1-(2-methoxyphenyl)-5-methyl-1H-1,2,3-triazol-4-yl]-1,2,4-thiadiazol-5-yl}benzamide
Chemical Structure Depiction of
4-tert-butyl-N-{3-[1-(2-methoxyphenyl)-5-methyl-1H-1,2,3-triazol-4-yl]-1,2,4-thiadiazol-5-yl}benzamide
4-tert-butyl-N-{3-[1-(2-methoxyphenyl)-5-methyl-1H-1,2,3-triazol-4-yl]-1,2,4-thiadiazol-5-yl}benzamide
Compound characteristics
| Compound ID: | C200-4715 |
| Compound Name: | 4-tert-butyl-N-{3-[1-(2-methoxyphenyl)-5-methyl-1H-1,2,3-triazol-4-yl]-1,2,4-thiadiazol-5-yl}benzamide |
| Molecular Weight: | 448.55 |
| Molecular Formula: | C23 H24 N6 O2 S |
| Smiles: | Cc1c(c2nc(NC(c3ccc(cc3)C(C)(C)C)=O)sn2)nnn1c1ccccc1OC |
| Stereo: | ACHIRAL |
| logP: | 5.1283 |
| logD: | 5.123 |
| logSw: | -5.0071 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 78.09 |
| InChI Key: | BPFQCVTVPWQPBE-UHFFFAOYSA-N |