N-(3-{1-[3-chloro-4-(trifluoromethyl)phenyl]-5-methyl-1H-1,2,3-triazol-4-yl}-1,2,4-thiadiazol-5-yl)furan-2-carboxamide
Chemical Structure Depiction of
N-(3-{1-[3-chloro-4-(trifluoromethyl)phenyl]-5-methyl-1H-1,2,3-triazol-4-yl}-1,2,4-thiadiazol-5-yl)furan-2-carboxamide
N-(3-{1-[3-chloro-4-(trifluoromethyl)phenyl]-5-methyl-1H-1,2,3-triazol-4-yl}-1,2,4-thiadiazol-5-yl)furan-2-carboxamide
Compound characteristics
| Compound ID: | C200-4996 |
| Compound Name: | N-(3-{1-[3-chloro-4-(trifluoromethyl)phenyl]-5-methyl-1H-1,2,3-triazol-4-yl}-1,2,4-thiadiazol-5-yl)furan-2-carboxamide |
| Molecular Weight: | 454.82 |
| Molecular Formula: | C17 H10 Cl F3 N6 O2 S |
| Smiles: | Cc1c(c2nc(NC(c3ccco3)=O)sn2)nnn1c1ccc(c(c1)[Cl])C(F)(F)F |
| Stereo: | ACHIRAL |
| logP: | 4.1904 |
| logD: | 4.1889 |
| logSw: | -4.7216 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 79.339 |
| InChI Key: | WJFXYXOKOJMKKS-UHFFFAOYSA-N |