5-methyl-N-(2-methylphenyl)-1-{[5-methyl-2-(3,4,5-trimethoxyphenyl)-1,3-oxazol-4-yl]methyl}-1H-1,2,3-triazole-4-carboxamide
Chemical Structure Depiction of
5-methyl-N-(2-methylphenyl)-1-{[5-methyl-2-(3,4,5-trimethoxyphenyl)-1,3-oxazol-4-yl]methyl}-1H-1,2,3-triazole-4-carboxamide
5-methyl-N-(2-methylphenyl)-1-{[5-methyl-2-(3,4,5-trimethoxyphenyl)-1,3-oxazol-4-yl]methyl}-1H-1,2,3-triazole-4-carboxamide
Compound characteristics
| Compound ID: | C200-5461 |
| Compound Name: | 5-methyl-N-(2-methylphenyl)-1-{[5-methyl-2-(3,4,5-trimethoxyphenyl)-1,3-oxazol-4-yl]methyl}-1H-1,2,3-triazole-4-carboxamide |
| Molecular Weight: | 477.52 |
| Molecular Formula: | C25 H27 N5 O5 |
| Smiles: | Cc1ccccc1NC(c1c(C)n(Cc2c(C)oc(c3cc(c(c(c3)OC)OC)OC)n2)nn1)=O |
| Stereo: | ACHIRAL |
| logP: | 2.9127 |
| logD: | 2.9088 |
| logSw: | -3.2874 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 90.439 |
| InChI Key: | ZRXOCSBRVQLZTK-UHFFFAOYSA-N |